C16H17N3O5S2 — CID 4791478
5-nitro-N-(3-piperidin-1-ylsulfonylphenyl)thiophene-2-carboxamide (PubChem CID 4791478) has the molecular formula C16H17N3O5S2 and a molecular weight of 395.46 g/mol. Its IUPAC name is 5-nitro-N-(3-piperidin-1-ylsulfonylphenyl)thiophene-2-carboxamide.
| Compound Name | 5-nitro-N-(3-piperidin-1-ylsulfonylphenyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 4791478 |
| Molecular Formula | C16H17N3O5S2 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.06 |
| IUPAC Name | 5-nitro-N-(3-piperidin-1-ylsulfonylphenyl)thiophene-2-carboxamide |
| SMILES | O=C(Nc1cccc(S(=O)(=O)N2CCCCC2)c1)c1ccc([N+](=O)[O-])s1 |
| InChI | InChI=1S/C16H17N3O5S2/c20-16(14-7-8-15(25-14)19(21)22)17-12-5-4-6-13(11-12)26(23,24)18-9-2-1-3-10-18/h4-8,11H,1-3,9-10H2,(H,17,20) |
| InChIKey | UXVKYKHDEKZAJX-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|