C17H12ClN3O5S2 — CID 26593085
N-[3-[(2-chlorophenyl)sulfamoyl]phenyl]-5-nitrothiophene-2-carboxamide (PubChem CID 26593085) has the molecular formula C17H12ClN3O5S2 and a molecular weight of 437.89 g/mol. Its IUPAC name is N-[3-[(2-chlorophenyl)sulfamoyl]phenyl]-5-nitrothiophene-2-carboxamide.
| Compound Name | N-[3-[(2-chlorophenyl)sulfamoyl]phenyl]-5-nitrothiophene-2-carboxamide |
|---|---|
| PubChem CID | 26593085 |
| Molecular Formula | C17H12ClN3O5S2 |
| Molecular Weight | 437.89 g/mol |
| Exact Mass | 436.99 |
| IUPAC Name | N-[3-[(2-chlorophenyl)sulfamoyl]phenyl]-5-nitrothiophene-2-carboxamide |
| SMILES | O=C(Nc1cccc(S(=O)(=O)Nc2ccccc2Cl)c1)c1ccc([N+](=O)[O-])s1 |
| InChI | InChI=1S/C17H12ClN3O5S2/c18-13-6-1-2-7-14(13)20-28(25,26)12-5-3-4-11(10-12)19-17(22)15-8-9-16(27-15)21(23)24/h1-10,20H,(H,19,22) |
| InChIKey | VZJNRRAHXVDTBI-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 118.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.89 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|