C20H24N2O5S2 — CID 26722877
3-(azepan-1-ylsulfonyl)-N-(3-methylsulfonylphenyl)benzamide (PubChem CID 26722877) has the molecular formula C20H24N2O5S2 and a molecular weight of 436.56 g/mol. Its IUPAC name is 3-(azepan-1-ylsulfonyl)-N-(3-methylsulfonylphenyl)benzamide.
| Compound Name | 3-(azepan-1-ylsulfonyl)-N-(3-methylsulfonylphenyl)benzamide |
|---|---|
| PubChem CID | 26722877 |
| Molecular Formula | C20H24N2O5S2 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.11 |
| IUPAC Name | 3-(azepan-1-ylsulfonyl)-N-(3-methylsulfonylphenyl)benzamide |
| SMILES | CS(=O)(=O)c1cccc(NC(=O)c2cccc(S(=O)(=O)N3CCCCCC3)c2)c1 |
| InChI | InChI=1S/C20H24N2O5S2/c1-28(24,25)18-10-7-9-17(15-18)21-20(23)16-8-6-11-19(14-16)29(26,27)22-12-4-2-3-5-13-22/h6-11,14-15H,2-5,12-13H2,1H3,(H,21,23) |
| InChIKey | KCAMAABEHNODRF-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |