C17H19N3O3S — CID 812621
3-piperidin-1-ylsulfonyl-N-pyridin-3-ylbenzamide (PubChem CID 812621) has the molecular formula C17H19N3O3S and a molecular weight of 345.42 g/mol. Its IUPAC name is 3-piperidin-1-ylsulfonyl-N-pyridin-3-ylbenzamide.
| Compound Name | 3-piperidin-1-ylsulfonyl-N-pyridin-3-ylbenzamide |
|---|---|
| PubChem CID | 812621 |
| Molecular Formula | C17H19N3O3S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | 3-piperidin-1-ylsulfonyl-N-pyridin-3-ylbenzamide |
| SMILES | O=C(Nc1cccnc1)c1cccc(S(=O)(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C17H19N3O3S/c21-17(19-15-7-5-9-18-13-15)14-6-4-8-16(12-14)24(22,23)20-10-2-1-3-11-20/h4-9,12-13H,1-3,10-11H2,(H,19,21) |
| InChIKey | YMFOKEHORIJDBR-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |