C19H20FN3O5S — CID 2370710
3-(azepan-1-ylsulfonyl)-N-(2-fluoro-5-nitrophenyl)benzamide (PubChem CID 2370710) has the molecular formula C19H20FN3O5S and a molecular weight of 421.45 g/mol. Its IUPAC name is 3-(azepan-1-ylsulfonyl)-N-(2-fluoro-5-nitrophenyl)benzamide.
| Compound Name | 3-(azepan-1-ylsulfonyl)-N-(2-fluoro-5-nitrophenyl)benzamide |
|---|---|
| PubChem CID | 2370710 |
| Molecular Formula | C19H20FN3O5S |
| Molecular Weight | 421.45 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | 3-(azepan-1-ylsulfonyl)-N-(2-fluoro-5-nitrophenyl)benzamide |
| SMILES | O=C(Nc1cc([N+](=O)[O-])ccc1F)c1cccc(S(=O)(=O)N2CCCCCC2)c1 |
| InChI | InChI=1S/C19H20FN3O5S/c20-17-9-8-15(23(25)26)13-18(17)21-19(24)14-6-5-7-16(12-14)29(27,28)22-10-3-1-2-4-11-22/h5-9,12-13H,1-4,10-11H2,(H,21,24) |
| InChIKey | BPVWYRAONRMLEC-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.45 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|