C19H24ClN3O3S — CID 119422102
N-(2-aminophenyl)-3-(azepan-1-ylsulfonyl)benzamide;hydrochloride (PubChem CID 119422102) has the molecular formula C19H24ClN3O3S and a molecular weight of 409.94 g/mol. Its IUPAC name is N-(2-aminophenyl)-3-(azepan-1-ylsulfonyl)benzamide;hydrochloride.
| Compound Name | N-(2-aminophenyl)-3-(azepan-1-ylsulfonyl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 119422102 |
| Molecular Formula | C19H24ClN3O3S |
| Molecular Weight | 409.94 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | N-(2-aminophenyl)-3-(azepan-1-ylsulfonyl)benzamide;hydrochloride |
| SMILES | Cl.Nc1ccccc1NC(=O)c1cccc(S(=O)(=O)N2CCCCCC2)c1 |
| InChI | InChI=1S/C19H23N3O3S.ClH/c20-17-10-3-4-11-18(17)21-19(23)15-8-7-9-16(14-15)26(24,25)22-12-5-1-2-6-13-22;/h3-4,7-11,14H,1-2,5-6,12-13,20H2,(H,21,23);1H |
| InChIKey | IOYBOYUDDXDTNM-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.94 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|