C20H22F2N2O4S — CID 7043681
3-(azepan-1-ylsulfonyl)-N-[2-(difluoromethoxy)phenyl]benzamide (PubChem CID 7043681) has the molecular formula C20H22F2N2O4S and a molecular weight of 424.47 g/mol. Its IUPAC name is 3-(azepan-1-ylsulfonyl)-N-[2-(difluoromethoxy)phenyl]benzamide.
| Compound Name | 3-(azepan-1-ylsulfonyl)-N-[2-(difluoromethoxy)phenyl]benzamide |
|---|---|
| PubChem CID | 7043681 |
| Molecular Formula | C20H22F2N2O4S |
| Molecular Weight | 424.47 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | 3-(azepan-1-ylsulfonyl)-N-[2-(difluoromethoxy)phenyl]benzamide |
| SMILES | O=C(Nc1ccccc1OC(F)F)c1cccc(S(=O)(=O)N2CCCCCC2)c1 |
| InChI | InChI=1S/C20H22F2N2O4S/c21-20(22)28-18-11-4-3-10-17(18)23-19(25)15-8-7-9-16(14-15)29(26,27)24-12-5-1-2-6-13-24/h3-4,7-11,14,20H,1-2,5-6,12-13H2,(H,23,25) |
| InChIKey | OEKFJKWDSAQYFV-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.47 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |