C18H17N2O5S- — CID 4094310
2-[(3-pyrrolidin-1-ylsulfonylbenzoyl)amino]benzoate (PubChem CID 4094310) has the molecular formula C18H17N2O5S- and a molecular weight of 373.41 g/mol. Its IUPAC name is 2-[(3-pyrrolidin-1-ylsulfonylbenzoyl)amino]benzoate.
| Compound Name | 2-[(3-pyrrolidin-1-ylsulfonylbenzoyl)amino]benzoate |
|---|---|
| PubChem CID | 4094310 |
| Molecular Formula | C18H17N2O5S- |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | 2-[(3-pyrrolidin-1-ylsulfonylbenzoyl)amino]benzoate |
| SMILES | O=C(Nc1ccccc1C(=O)[O-])c1cccc(S(=O)(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C18H18N2O5S/c21-17(19-16-9-2-1-8-15(16)18(22)23)13-6-5-7-14(12-13)26(24,25)20-10-3-4-11-20/h1-2,5-9,12H,3-4,10-11H2,(H,19,21)(H,22,23)/p-1 |
| InChIKey | NVUUTGOWYOEBGY-UHFFFAOYSA-M |
| XLogP | 1.09 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |