C26H33N3O4S — CID 15996952
3-(azepan-1-ylsulfonyl)-N-[2-(4-methylpiperidine-1-carbonyl)phenyl]benzamide (PubChem CID 15996952) has the molecular formula C26H33N3O4S and a molecular weight of 483.63 g/mol. Its IUPAC name is 3-(azepan-1-ylsulfonyl)-N-[2-(4-methylpiperidine-1-carbonyl)phenyl]benzamide.
| Compound Name | 3-(azepan-1-ylsulfonyl)-N-[2-(4-methylpiperidine-1-carbonyl)phenyl]benzamide |
|---|---|
| PubChem CID | 15996952 |
| Molecular Formula | C26H33N3O4S |
| Molecular Weight | 483.63 g/mol |
| Exact Mass | 483.22 |
| IUPAC Name | 3-(azepan-1-ylsulfonyl)-N-[2-(4-methylpiperidine-1-carbonyl)phenyl]benzamide |
| SMILES | CC1CCN(C(=O)c2ccccc2NC(=O)c2cccc(S(=O)(=O)N3CCCCCC3)c2)CC1 |
| InChI | InChI=1S/C26H33N3O4S/c1-20-13-17-28(18-14-20)26(31)23-11-4-5-12-24(23)27-25(30)21-9-8-10-22(19-21)34(32,33)29-15-6-2-3-7-16-29/h4-5,8-12,19-20H,2-3,6-7,13-18H2,1H3,(H,27,30) |
| InChIKey | UEEAXDOYOAWPPV-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.63 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |