C26H33N3O5S — CID 28591285
2-methoxy-5-(4-methylpiperidin-1-yl)sulfonyl-N-[2-(piperidine-1-carbonyl)phenyl]benzamide (PubChem CID 28591285) has the molecular formula C26H33N3O5S and a molecular weight of 499.63 g/mol. Its IUPAC name is 2-methoxy-5-(4-methylpiperidin-1-yl)sulfonyl-N-[2-(piperidine-1-carbonyl)phenyl]benzamide.
| Compound Name | 2-methoxy-5-(4-methylpiperidin-1-yl)sulfonyl-N-[2-(piperidine-1-carbonyl)phenyl]benzamide |
|---|---|
| PubChem CID | 28591285 |
| Molecular Formula | C26H33N3O5S |
| Molecular Weight | 499.63 g/mol |
| Exact Mass | 499.21 |
| IUPAC Name | 2-methoxy-5-(4-methylpiperidin-1-yl)sulfonyl-N-[2-(piperidine-1-carbonyl)phenyl]benzamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCC(C)CC2)cc1C(=O)Nc1ccccc1C(=O)N1CCCCC1 |
| InChI | InChI=1S/C26H33N3O5S/c1-19-12-16-29(17-13-19)35(32,33)20-10-11-24(34-2)22(18-20)25(30)27-23-9-5-4-8-21(23)26(31)28-14-6-3-7-15-28/h4-5,8-11,18-19H,3,6-7,12-17H2,1-2H3,(H,27,30) |
| InChIKey | FPXVASIITYYEHZ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.63 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |