C25H33N3O4S — CID 28591235
(4-benzylpiperazin-1-yl)-[2-methoxy-5-(4-methylpiperidin-1-yl)sulfonylphenyl]methanone (PubChem CID 28591235) has the molecular formula C25H33N3O4S and a molecular weight of 471.62 g/mol. Its IUPAC name is (4-benzylpiperazin-1-yl)-[2-methoxy-5-(4-methylpiperidin-1-yl)sulfonylphenyl]methanone.
| Compound Name | (4-benzylpiperazin-1-yl)-[2-methoxy-5-(4-methylpiperidin-1-yl)sulfonylphenyl]methanone |
|---|---|
| PubChem CID | 28591235 |
| Molecular Formula | C25H33N3O4S |
| Molecular Weight | 471.62 g/mol |
| Exact Mass | 471.22 |
| IUPAC Name | (4-benzylpiperazin-1-yl)-[2-methoxy-5-(4-methylpiperidin-1-yl)sulfonylphenyl]methanone |
| SMILES | COc1ccc(S(=O)(=O)N2CCC(C)CC2)cc1C(=O)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C25H33N3O4S/c1-20-10-12-28(13-11-20)33(30,31)22-8-9-24(32-2)23(18-22)25(29)27-16-14-26(15-17-27)19-21-6-4-3-5-7-21/h3-9,18,20H,10-17,19H2,1-2H3 |
| InChIKey | BPQISYSTPZHVQZ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.62 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |