C24H30BrN3O3S — CID 4000795
(4-benzylpiperazin-1-yl)-[3-bromo-5-(4-methylpiperidin-1-yl)sulfonylphenyl]methanone (PubChem CID 4000795) has the molecular formula C24H30BrN3O3S and a molecular weight of 520.49 g/mol. Its IUPAC name is (4-benzylpiperazin-1-yl)-[3-bromo-5-(4-methylpiperidin-1-yl)sulfonylphenyl]methanone.
| Compound Name | (4-benzylpiperazin-1-yl)-[3-bromo-5-(4-methylpiperidin-1-yl)sulfonylphenyl]methanone |
|---|---|
| PubChem CID | 4000795 |
| Molecular Formula | C24H30BrN3O3S |
| Molecular Weight | 520.49 g/mol |
| Exact Mass | 519.12 |
| IUPAC Name | (4-benzylpiperazin-1-yl)-[3-bromo-5-(4-methylpiperidin-1-yl)sulfonylphenyl]methanone |
| SMILES | CC1CCN(S(=O)(=O)c2cc(Br)cc(C(=O)N3CCN(Cc4ccccc4)CC3)c2)CC1 |
| InChI | InChI=1S/C24H30BrN3O3S/c1-19-7-9-28(10-8-19)32(30,31)23-16-21(15-22(25)17-23)24(29)27-13-11-26(12-14-27)18-20-5-3-2-4-6-20/h2-6,15-17,19H,7-14,18H2,1H3 |
| InChIKey | WKZAAGJUGDLKOX-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.49 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |