C20H29N3O2 — CID 108942723
1-(4-benzylpiperazin-1-yl)-3-(4-methylpiperidin-1-yl)propane-1,3-dione (PubChem CID 108942723) has the molecular formula C20H29N3O2 and a molecular weight of 343.47 g/mol. Its IUPAC name is 1-(4-benzylpiperazin-1-yl)-3-(4-methylpiperidin-1-yl)propane-1,3-dione.
| Compound Name | 1-(4-benzylpiperazin-1-yl)-3-(4-methylpiperidin-1-yl)propane-1,3-dione |
|---|---|
| PubChem CID | 108942723 |
| Molecular Formula | C20H29N3O2 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | 1-(4-benzylpiperazin-1-yl)-3-(4-methylpiperidin-1-yl)propane-1,3-dione |
| SMILES | CC1CCN(C(=O)CC(=O)N2CCN(Cc3ccccc3)CC2)CC1 |
| InChI | InChI=1S/C20H29N3O2/c1-17-7-9-22(10-8-17)19(24)15-20(25)23-13-11-21(12-14-23)16-18-5-3-2-4-6-18/h2-6,17H,7-16H2,1H3 |
| InChIKey | LRNJZPQCGMOIPQ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|