C25H32N4O2 — CID 13023421
1,3-bis(4-benzylpiperazin-1-yl)propane-1,3-dione (PubChem CID 13023421) has the molecular formula C25H32N4O2 and a molecular weight of 420.56 g/mol. Its IUPAC name is 1,3-bis(4-benzylpiperazin-1-yl)propane-1,3-dione.
| Compound Name | 1,3-bis(4-benzylpiperazin-1-yl)propane-1,3-dione |
|---|---|
| PubChem CID | 13023421 |
| Molecular Formula | C25H32N4O2 |
| Molecular Weight | 420.56 g/mol |
| Exact Mass | 420.25 |
| IUPAC Name | 1,3-bis(4-benzylpiperazin-1-yl)propane-1,3-dione |
| SMILES | O=C(CC(=O)N1CCN(Cc2ccccc2)CC1)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C25H32N4O2/c30-24(28-15-11-26(12-16-28)20-22-7-3-1-4-8-22)19-25(31)29-17-13-27(14-18-29)21-23-9-5-2-6-10-23/h1-10H,11-21H2 |
| InChIKey | KBMHLFZGPLQEAX-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 47.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.56 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|