C25H33N3O — CID 126191918
[4-[(4-benzylpiperazin-1-yl)methyl]phenyl]-(4-methylpiperidin-1-yl)methanone (PubChem CID 126191918) has the molecular formula C25H33N3O and a molecular weight of 391.56 g/mol. Its IUPAC name is [4-[(4-benzylpiperazin-1-yl)methyl]phenyl]-(4-methylpiperidin-1-yl)methanone.
| Compound Name | [4-[(4-benzylpiperazin-1-yl)methyl]phenyl]-(4-methylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 126191918 |
| Molecular Formula | C25H33N3O |
| Molecular Weight | 391.56 g/mol |
| Exact Mass | 391.26 |
| IUPAC Name | [4-[(4-benzylpiperazin-1-yl)methyl]phenyl]-(4-methylpiperidin-1-yl)methanone |
| SMILES | CC1CCN(C(=O)c2ccc(CN3CCN(Cc4ccccc4)CC3)cc2)CC1 |
| InChI | InChI=1S/C25H33N3O/c1-21-11-13-28(14-12-21)25(29)24-9-7-23(8-10-24)20-27-17-15-26(16-18-27)19-22-5-3-2-4-6-22/h2-10,21H,11-20H2,1H3 |
| InChIKey | OHNPJMPXKFUWFR-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.56 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |