C19H28ClN3O3S — CID 28591390
[2-chloro-5-(4-methylpiperidin-1-yl)sulfonylphenyl]-(4-ethylpiperazin-1-yl)methanone (PubChem CID 28591390) has the molecular formula C19H28ClN3O3S and a molecular weight of 413.97 g/mol. Its IUPAC name is [2-chloro-5-(4-methylpiperidin-1-yl)sulfonylphenyl]-(4-ethylpiperazin-1-yl)methanone.
| Compound Name | [2-chloro-5-(4-methylpiperidin-1-yl)sulfonylphenyl]-(4-ethylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 28591390 |
| Molecular Formula | C19H28ClN3O3S |
| Molecular Weight | 413.97 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | [2-chloro-5-(4-methylpiperidin-1-yl)sulfonylphenyl]-(4-ethylpiperazin-1-yl)methanone |
| SMILES | CCN1CCN(C(=O)c2cc(S(=O)(=O)N3CCC(C)CC3)ccc2Cl)CC1 |
| InChI | InChI=1S/C19H28ClN3O3S/c1-3-21-10-12-22(13-11-21)19(24)17-14-16(4-5-18(17)20)27(25,26)23-8-6-15(2)7-9-23/h4-5,14-15H,3,6-13H2,1-2H3 |
| InChIKey | SSFYLIKZVWSVBA-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.97 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |