C22H34N4O3S — CID 134016872
(4-ethylpiperazin-1-yl)-(5-piperidin-1-ylsulfonyl-2-pyrrolidin-1-ylphenyl)methanone (PubChem CID 134016872) has the molecular formula C22H34N4O3S and a molecular weight of 434.61 g/mol. Its IUPAC name is (4-ethylpiperazin-1-yl)-(5-piperidin-1-ylsulfonyl-2-pyrrolidin-1-ylphenyl)methanone.
| Compound Name | (4-ethylpiperazin-1-yl)-(5-piperidin-1-ylsulfonyl-2-pyrrolidin-1-ylphenyl)methanone |
|---|---|
| PubChem CID | 134016872 |
| Molecular Formula | C22H34N4O3S |
| Molecular Weight | 434.61 g/mol |
| Exact Mass | 434.24 |
| IUPAC Name | (4-ethylpiperazin-1-yl)-(5-piperidin-1-ylsulfonyl-2-pyrrolidin-1-ylphenyl)methanone |
| SMILES | CCN1CCN(C(=O)c2cc(S(=O)(=O)N3CCCCC3)ccc2N2CCCC2)CC1 |
| InChI | InChI=1S/C22H34N4O3S/c1-2-23-14-16-25(17-15-23)22(27)20-18-19(8-9-21(20)24-10-6-7-11-24)30(28,29)26-12-4-3-5-13-26/h8-9,18H,2-7,10-17H2,1H3 |
| InChIKey | RGTMCZUSAZMJDX-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 64.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.61 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |