C17H23ClN2O3S — CID 1069862
(2-chloro-5-piperidin-1-ylsulfonylphenyl)-piperidin-1-ylmethanone (PubChem CID 1069862) has the molecular formula C17H23ClN2O3S and a molecular weight of 370.90 g/mol. Its IUPAC name is (2-chloro-5-piperidin-1-ylsulfonylphenyl)-piperidin-1-ylmethanone.
| Compound Name | (2-chloro-5-piperidin-1-ylsulfonylphenyl)-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 1069862 |
| Molecular Formula | C17H23ClN2O3S |
| Molecular Weight | 370.90 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | (2-chloro-5-piperidin-1-ylsulfonylphenyl)-piperidin-1-ylmethanone |
| SMILES | O=C(c1cc(S(=O)(=O)N2CCCCC2)ccc1Cl)N1CCCCC1 |
| InChI | InChI=1S/C17H23ClN2O3S/c18-16-8-7-14(24(22,23)20-11-5-2-6-12-20)13-15(16)17(21)19-9-3-1-4-10-19/h7-8,13H,1-6,9-12H2 |
| InChIKey | YGDWVXJUORWKEU-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.90 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |