C21H30ClN3O3S2 — CID 20974074
(2-chloro-5-thiomorpholin-4-ylsulfonylphenyl)-(4-piperidin-1-ylpiperidin-1-yl)methanone (PubChem CID 20974074) has the molecular formula C21H30ClN3O3S2 and a molecular weight of 472.08 g/mol. Its IUPAC name is (2-chloro-5-thiomorpholin-4-ylsulfonylphenyl)-(4-piperidin-1-ylpiperidin-1-yl)methanone.
| Compound Name | (2-chloro-5-thiomorpholin-4-ylsulfonylphenyl)-(4-piperidin-1-ylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 20974074 |
| Molecular Formula | C21H30ClN3O3S2 |
| Molecular Weight | 472.08 g/mol |
| Exact Mass | 471.14 |
| IUPAC Name | (2-chloro-5-thiomorpholin-4-ylsulfonylphenyl)-(4-piperidin-1-ylpiperidin-1-yl)methanone |
| SMILES | O=C(c1cc(S(=O)(=O)N2CCSCC2)ccc1Cl)N1CCC(N2CCCCC2)CC1 |
| InChI | InChI=1S/C21H30ClN3O3S2/c22-20-5-4-18(30(27,28)25-12-14-29-15-13-25)16-19(20)21(26)24-10-6-17(7-11-24)23-8-2-1-3-9-23/h4-5,16-17H,1-3,6-15H2 |
| InChIKey | NIMWRWCDNJITHX-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.08 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |