C16H22Cl2N2O2S — CID 23738911
1-cyclohexyl-4-(3,4-dichlorophenyl)sulfonylpiperazine (PubChem CID 23738911) has the molecular formula C16H22Cl2N2O2S and a molecular weight of 377.34 g/mol. Its IUPAC name is 1-cyclohexyl-4-(3,4-dichlorophenyl)sulfonylpiperazine.
| Compound Name | 1-cyclohexyl-4-(3,4-dichlorophenyl)sulfonylpiperazine |
|---|---|
| PubChem CID | 23738911 |
| Molecular Formula | C16H22Cl2N2O2S |
| Molecular Weight | 377.34 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | 1-cyclohexyl-4-(3,4-dichlorophenyl)sulfonylpiperazine |
| SMILES | O=S(=O)(c1ccc(Cl)c(Cl)c1)N1CCN(C2CCCCC2)CC1 |
| InChI | InChI=1S/C16H22Cl2N2O2S/c17-15-7-6-14(12-16(15)18)23(21,22)20-10-8-19(9-11-20)13-4-2-1-3-5-13/h6-7,12-13H,1-5,8-11H2 |
| InChIKey | PEARSUVZMMHAIB-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.34 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |