C15H22Cl2N2O2S — CID 163331803
1-(3-chlorophenyl)sulfonyl-4-cyclopentylpiperazine;hydrochloride (PubChem CID 163331803) has the molecular formula C15H22Cl2N2O2S and a molecular weight of 365.33 g/mol. Its IUPAC name is 1-(3-chlorophenyl)sulfonyl-4-cyclopentylpiperazine;hydrochloride.
| Compound Name | 1-(3-chlorophenyl)sulfonyl-4-cyclopentylpiperazine;hydrochloride |
|---|---|
| PubChem CID | 163331803 |
| Molecular Formula | C15H22Cl2N2O2S |
| Molecular Weight | 365.33 g/mol |
| Exact Mass | 364.08 |
| IUPAC Name | 1-(3-chlorophenyl)sulfonyl-4-cyclopentylpiperazine;hydrochloride |
| SMILES | Cl.O=S(=O)(c1cccc(Cl)c1)N1CCN(C2CCCC2)CC1 |
| InChI | InChI=1S/C15H21ClN2O2S.ClH/c16-13-4-3-7-15(12-13)21(19,20)18-10-8-17(9-11-18)14-5-1-2-6-14;/h3-4,7,12,14H,1-2,5-6,8-11H2;1H |
| InChIKey | RNYSRQNWMDZTMO-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.33 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |