C17H25ClN2O2S — CID 113073090
1-(4-chloro-3-methylphenyl)sulfonyl-4-cyclohexylpiperazine (PubChem CID 113073090) has the molecular formula C17H25ClN2O2S and a molecular weight of 356.92 g/mol. Its IUPAC name is 1-(4-chloro-3-methylphenyl)sulfonyl-4-cyclohexylpiperazine.
| Compound Name | 1-(4-chloro-3-methylphenyl)sulfonyl-4-cyclohexylpiperazine |
|---|---|
| PubChem CID | 113073090 |
| Molecular Formula | C17H25ClN2O2S |
| Molecular Weight | 356.92 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | 1-(4-chloro-3-methylphenyl)sulfonyl-4-cyclohexylpiperazine |
| SMILES | Cc1cc(S(=O)(=O)N2CCN(C3CCCCC3)CC2)ccc1Cl |
| InChI | InChI=1S/C17H25ClN2O2S/c1-14-13-16(7-8-17(14)18)23(21,22)20-11-9-19(10-12-20)15-5-3-2-4-6-15/h7-8,13,15H,2-6,9-12H2,1H3 |
| InChIKey | MRROVJAOBZUKFR-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.92 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |