C19H28N2O4S — CID 43816542
1-cycloheptyl-4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)piperazine (PubChem CID 43816542) has the molecular formula C19H28N2O4S and a molecular weight of 380.51 g/mol. Its IUPAC name is 1-cycloheptyl-4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)piperazine.
| Compound Name | 1-cycloheptyl-4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)piperazine |
|---|---|
| PubChem CID | 43816542 |
| Molecular Formula | C19H28N2O4S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | 1-cycloheptyl-4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)piperazine |
| SMILES | O=S(=O)(c1ccc2c(c1)OCCO2)N1CCN(C2CCCCCC2)CC1 |
| InChI | InChI=1S/C19H28N2O4S/c22-26(23,17-7-8-18-19(15-17)25-14-13-24-18)21-11-9-20(10-12-21)16-5-3-1-2-4-6-16/h7-8,15-16H,1-6,9-14H2 |
| InChIKey | VFABAJXIFMVKKK-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |