C23H33N3O6S — CID 55806478
N-[2-(cyclohexanecarbonylamino)ethyl]-1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)piperidine-4-carboxamide (PubChem CID 55806478) has the molecular formula C23H33N3O6S and a molecular weight of 479.60 g/mol. Its IUPAC name is N-[2-(cyclohexanecarbonylamino)ethyl]-1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)piperidine-4-carboxamide.
| Compound Name | N-[2-(cyclohexanecarbonylamino)ethyl]-1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55806478 |
| Molecular Formula | C23H33N3O6S |
| Molecular Weight | 479.60 g/mol |
| Exact Mass | 479.21 |
| IUPAC Name | N-[2-(cyclohexanecarbonylamino)ethyl]-1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)piperidine-4-carboxamide |
| SMILES | O=C(NCCNC(=O)C1CCN(S(=O)(=O)c2ccc3c(c2)OCCO3)CC1)C1CCCCC1 |
| InChI | InChI=1S/C23H33N3O6S/c27-22(17-4-2-1-3-5-17)24-10-11-25-23(28)18-8-12-26(13-9-18)33(29,30)19-6-7-20-21(16-19)32-15-14-31-20/h6-7,16-18H,1-5,8-15H2,(H,24,27)(H,25,28) |
| InChIKey | RFNSRVVZQQKLEJ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.60 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|