C25H30N2O6S — CID 55903275
1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-N-[2-(2,3-dihydro-1H-inden-5-yloxy)ethyl]piperidine-4-carboxamide (PubChem CID 55903275) has the molecular formula C25H30N2O6S and a molecular weight of 486.59 g/mol. Its IUPAC name is 1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-N-[2-(2,3-dihydro-1H-inden-5-yloxy)ethyl]piperidine-4-carboxamide.
| Compound Name | 1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-N-[2-(2,3-dihydro-1H-inden-5-yloxy)ethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55903275 |
| Molecular Formula | C25H30N2O6S |
| Molecular Weight | 486.59 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | 1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-N-[2-(2,3-dihydro-1H-inden-5-yloxy)ethyl]piperidine-4-carboxamide |
| SMILES | O=C(NCCOc1ccc2c(c1)CCC2)C1CCN(S(=O)(=O)c2ccc3c(c2)OCCO3)CC1 |
| InChI | InChI=1S/C25H30N2O6S/c28-25(26-10-13-31-21-5-4-18-2-1-3-20(18)16-21)19-8-11-27(12-9-19)34(29,30)22-6-7-23-24(17-22)33-15-14-32-23/h4-7,16-17,19H,1-3,8-15H2,(H,26,28) |
| InChIKey | IQNYLCKGEKBQAC-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.59 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|