C25H37N3O5S — CID 55953557
1-[1-(2,3-dihydro-1H-inden-5-ylsulfonyl)piperidine-4-carbonyl]-N-(3-methoxypropyl)piperidine-4-carboxamide (PubChem CID 55953557) has the molecular formula C25H37N3O5S and a molecular weight of 491.65 g/mol. Its IUPAC name is 1-[1-(2,3-dihydro-1H-inden-5-ylsulfonyl)piperidine-4-carbonyl]-N-(3-methoxypropyl)piperidine-4-carboxamide.
| Compound Name | 1-[1-(2,3-dihydro-1H-inden-5-ylsulfonyl)piperidine-4-carbonyl]-N-(3-methoxypropyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55953557 |
| Molecular Formula | C25H37N3O5S |
| Molecular Weight | 491.65 g/mol |
| Exact Mass | 491.25 |
| IUPAC Name | 1-[1-(2,3-dihydro-1H-inden-5-ylsulfonyl)piperidine-4-carbonyl]-N-(3-methoxypropyl)piperidine-4-carboxamide |
| SMILES | COCCCNC(=O)C1CCN(C(=O)C2CCN(S(=O)(=O)c3ccc4c(c3)CCC4)CC2)CC1 |
| InChI | InChI=1S/C25H37N3O5S/c1-33-17-3-12-26-24(29)20-8-13-27(14-9-20)25(30)21-10-15-28(16-11-21)34(31,32)23-7-6-19-4-2-5-22(19)18-23/h6-7,18,20-21H,2-5,8-17H2,1H3,(H,26,29) |
| InChIKey | DXJIVJUOVRXMIY-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.65 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|