C24H37N3O3S — CID 27743802
N-(3-piperidin-1-ylpropyl)-1-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)piperidine-4-carboxamide (PubChem CID 27743802) has the molecular formula C24H37N3O3S and a molecular weight of 447.65 g/mol. Its IUPAC name is N-(3-piperidin-1-ylpropyl)-1-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)piperidine-4-carboxamide.
| Compound Name | N-(3-piperidin-1-ylpropyl)-1-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 27743802 |
| Molecular Formula | C24H37N3O3S |
| Molecular Weight | 447.65 g/mol |
| Exact Mass | 447.26 |
| IUPAC Name | N-(3-piperidin-1-ylpropyl)-1-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)piperidine-4-carboxamide |
| SMILES | O=C(NCCCN1CCCCC1)C1CCN(S(=O)(=O)c2ccc3c(c2)CCCC3)CC1 |
| InChI | InChI=1S/C24H37N3O3S/c28-24(25-13-6-16-26-14-4-1-5-15-26)21-11-17-27(18-12-21)31(29,30)23-10-9-20-7-2-3-8-22(20)19-23/h9-10,19,21H,1-8,11-18H2,(H,25,28) |
| InChIKey | XZEHZNXCBBWMHC-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.65 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|