C25H30FN3O4S — CID 55973791
N-[2-[(2-fluorobenzoyl)amino]ethyl]-1-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)piperidine-4-carboxamide (PubChem CID 55973791) has the molecular formula C25H30FN3O4S and a molecular weight of 487.60 g/mol. Its IUPAC name is N-[2-[(2-fluorobenzoyl)amino]ethyl]-1-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)piperidine-4-carboxamide.
| Compound Name | N-[2-[(2-fluorobenzoyl)amino]ethyl]-1-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55973791 |
| Molecular Formula | C25H30FN3O4S |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.19 |
| IUPAC Name | N-[2-[(2-fluorobenzoyl)amino]ethyl]-1-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)piperidine-4-carboxamide |
| SMILES | O=C(NCCNC(=O)C1CCN(S(=O)(=O)c2ccc3c(c2)CCCC3)CC1)c1ccccc1F |
| InChI | InChI=1S/C25H30FN3O4S/c26-23-8-4-3-7-22(23)25(31)28-14-13-27-24(30)19-11-15-29(16-12-19)34(32,33)21-10-9-18-5-1-2-6-20(18)17-21/h3-4,7-10,17,19H,1-2,5-6,11-16H2,(H,27,30)(H,28,31) |
| InChIKey | FMTAISLZFVTQSI-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|