C23H27N3O4S — CID 46807195
1-(2,3-dihydro-1H-inden-5-ylsulfonyl)-N'-(2-methylbenzoyl)piperidine-4-carbohydrazide (PubChem CID 46807195) has the molecular formula C23H27N3O4S and a molecular weight of 441.55 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-inden-5-ylsulfonyl)-N'-(2-methylbenzoyl)piperidine-4-carbohydrazide.
| Compound Name | 1-(2,3-dihydro-1H-inden-5-ylsulfonyl)-N'-(2-methylbenzoyl)piperidine-4-carbohydrazide |
|---|---|
| PubChem CID | 46807195 |
| Molecular Formula | C23H27N3O4S |
| Molecular Weight | 441.55 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | 1-(2,3-dihydro-1H-inden-5-ylsulfonyl)-N'-(2-methylbenzoyl)piperidine-4-carbohydrazide |
| SMILES | Cc1ccccc1C(=O)NNC(=O)C1CCN(S(=O)(=O)c2ccc3c(c2)CCC3)CC1 |
| InChI | InChI=1S/C23H27N3O4S/c1-16-5-2-3-8-21(16)23(28)25-24-22(27)18-11-13-26(14-12-18)31(29,30)20-10-9-17-6-4-7-19(17)15-20/h2-3,5,8-10,15,18H,4,6-7,11-14H2,1H3,(H,24,27)(H,25,28) |
| InChIKey | SVBNJCIYOXLKHH-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.55 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|