C21H24BrN3O4S — CID 4807992
N'-(2-bromobenzoyl)-1-(3,4-dimethylphenyl)sulfonylpiperidine-4-carbohydrazide (PubChem CID 4807992) has the molecular formula C21H24BrN3O4S and a molecular weight of 494.41 g/mol. Its IUPAC name is N'-(2-bromobenzoyl)-1-(3,4-dimethylphenyl)sulfonylpiperidine-4-carbohydrazide.
| Compound Name | N'-(2-bromobenzoyl)-1-(3,4-dimethylphenyl)sulfonylpiperidine-4-carbohydrazide |
|---|---|
| PubChem CID | 4807992 |
| Molecular Formula | C21H24BrN3O4S |
| Molecular Weight | 494.41 g/mol |
| Exact Mass | 493.07 |
| IUPAC Name | N'-(2-bromobenzoyl)-1-(3,4-dimethylphenyl)sulfonylpiperidine-4-carbohydrazide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC(C(=O)NNC(=O)c3ccccc3Br)CC2)cc1C |
| InChI | InChI=1S/C21H24BrN3O4S/c1-14-7-8-17(13-15(14)2)30(28,29)25-11-9-16(10-12-25)20(26)23-24-21(27)18-5-3-4-6-19(18)22/h3-8,13,16H,9-12H2,1-2H3,(H,23,26)(H,24,27) |
| InChIKey | QQDQEOBOPSADMY-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.41 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|