C23H29N3O4S — CID 55349850
N'-(2-methylbenzoyl)-1-(2,4,6-trimethylphenyl)sulfonylpiperidine-4-carbohydrazide (PubChem CID 55349850) has the molecular formula C23H29N3O4S and a molecular weight of 443.57 g/mol. Its IUPAC name is N'-(2-methylbenzoyl)-1-(2,4,6-trimethylphenyl)sulfonylpiperidine-4-carbohydrazide.
| Compound Name | N'-(2-methylbenzoyl)-1-(2,4,6-trimethylphenyl)sulfonylpiperidine-4-carbohydrazide |
|---|---|
| PubChem CID | 55349850 |
| Molecular Formula | C23H29N3O4S |
| Molecular Weight | 443.57 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | N'-(2-methylbenzoyl)-1-(2,4,6-trimethylphenyl)sulfonylpiperidine-4-carbohydrazide |
| SMILES | Cc1cc(C)c(S(=O)(=O)N2CCC(C(=O)NNC(=O)c3ccccc3C)CC2)c(C)c1 |
| InChI | InChI=1S/C23H29N3O4S/c1-15-13-17(3)21(18(4)14-15)31(29,30)26-11-9-19(10-12-26)22(27)24-25-23(28)20-8-6-5-7-16(20)2/h5-8,13-14,19H,9-12H2,1-4H3,(H,24,27)(H,25,28) |
| InChIKey | JQNJFDJBFJZBGP-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.57 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|