C24H29N3O5S — CID 30872420
1-(2,3-dihydro-1H-inden-5-ylsulfonyl)-N'-[2-(3-methylphenoxy)acetyl]piperidine-4-carbohydrazide (PubChem CID 30872420) has the molecular formula C24H29N3O5S and a molecular weight of 471.58 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-inden-5-ylsulfonyl)-N'-[2-(3-methylphenoxy)acetyl]piperidine-4-carbohydrazide.
| Compound Name | 1-(2,3-dihydro-1H-inden-5-ylsulfonyl)-N'-[2-(3-methylphenoxy)acetyl]piperidine-4-carbohydrazide |
|---|---|
| PubChem CID | 30872420 |
| Molecular Formula | C24H29N3O5S |
| Molecular Weight | 471.58 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | 1-(2,3-dihydro-1H-inden-5-ylsulfonyl)-N'-[2-(3-methylphenoxy)acetyl]piperidine-4-carbohydrazide |
| SMILES | Cc1cccc(OCC(=O)NNC(=O)C2CCN(S(=O)(=O)c3ccc4c(c3)CCC4)CC2)c1 |
| InChI | InChI=1S/C24H29N3O5S/c1-17-4-2-7-21(14-17)32-16-23(28)25-26-24(29)19-10-12-27(13-11-19)33(30,31)22-9-8-18-5-3-6-20(18)15-22/h2,4,7-9,14-15,19H,3,5-6,10-13,16H2,1H3,(H,25,28)(H,26,29) |
| InChIKey | MCHQNQPYPWJSRX-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.58 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|