C23H27NO4S — CID 18274396
(3,5-dimethylphenyl) 1-(2,3-dihydro-1H-inden-5-ylsulfonyl)piperidine-4-carboxylate (PubChem CID 18274396) has the molecular formula C23H27NO4S and a molecular weight of 413.54 g/mol. Its IUPAC name is (3,5-dimethylphenyl) 1-(2,3-dihydro-1H-inden-5-ylsulfonyl)piperidine-4-carboxylate.
| Compound Name | (3,5-dimethylphenyl) 1-(2,3-dihydro-1H-inden-5-ylsulfonyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 18274396 |
| Molecular Formula | C23H27NO4S |
| Molecular Weight | 413.54 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | (3,5-dimethylphenyl) 1-(2,3-dihydro-1H-inden-5-ylsulfonyl)piperidine-4-carboxylate |
| SMILES | Cc1cc(C)cc(OC(=O)C2CCN(S(=O)(=O)c3ccc4c(c3)CCC4)CC2)c1 |
| InChI | InChI=1S/C23H27NO4S/c1-16-12-17(2)14-21(13-16)28-23(25)19-8-10-24(11-9-19)29(26,27)22-7-6-18-4-3-5-20(18)15-22/h6-7,12-15,19H,3-5,8-11H2,1-2H3 |
| InChIKey | SBTPLGQCUCKTJK-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.54 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|