C19H21NO4S — CID 9097380
(3,5-dimethylphenyl) 4-pyrrolidin-1-ylsulfonylbenzoate (PubChem CID 9097380) has the molecular formula C19H21NO4S and a molecular weight of 359.45 g/mol. Its IUPAC name is (3,5-dimethylphenyl) 4-pyrrolidin-1-ylsulfonylbenzoate.
| Compound Name | (3,5-dimethylphenyl) 4-pyrrolidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 9097380 |
| Molecular Formula | C19H21NO4S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | (3,5-dimethylphenyl) 4-pyrrolidin-1-ylsulfonylbenzoate |
| SMILES | Cc1cc(C)cc(OC(=O)c2ccc(S(=O)(=O)N3CCCC3)cc2)c1 |
| InChI | InChI=1S/C19H21NO4S/c1-14-11-15(2)13-17(12-14)24-19(21)16-5-7-18(8-6-16)25(22,23)20-9-3-4-10-20/h5-8,11-13H,3-4,9-10H2,1-2H3 |
| InChIKey | RZKCHEZMTBKUDT-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|