About (3-nitrophenyl) 4-pyrrolidin-1-ylsulfonylbenzoate
(3-nitrophenyl) 4-pyrrolidin-1-ylsulfonylbenzoate (PubChem CID 4812746) has the molecular formula C17H16N2O6S
and a molecular weight of 376.39 g/mol. Its IUPAC name is (3-nitrophenyl) 4-pyrrolidin-1-ylsulfonylbenzoate.
Molecular Properties
| Compound Name | (3-nitrophenyl) 4-pyrrolidin-1-ylsulfonylbenzoate |
| PubChem CID | 4812746 |
| Molecular Formula | C17H16N2O6S |
| Molecular Weight | 376.39 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | (3-nitrophenyl) 4-pyrrolidin-1-ylsulfonylbenzoate |
| SMILES | O=C(Oc1cccc([N+](=O)[O-])c1)c1ccc(S(=O)(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C17H16N2O6S/c20-17(25-15-5-3-4-14(12-15)19(21)22)13-6-8-16(9-7-13)26(23,24)18-10-1-2-11-18/h3-9,12H,1-2,10-11H2 |
| InChIKey | ADTSJWAMNAXRSS-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.39 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (3-nitrophenyl) 4-pyrrolidin-1-ylsulfonylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-nitrophenyl) 4-pyrrolidin-1-ylsulfonylbenzoate?
The IUPAC name of (3-nitrophenyl) 4-pyrrolidin-1-ylsulfonylbenzoate (CID 4812746) is (3-nitrophenyl) 4-pyrrolidin-1-ylsulfonylbenzoate.
What is the SMILES notation for (3-nitrophenyl) 4-pyrrolidin-1-ylsulfonylbenzoate?
The canonical SMILES for (3-nitrophenyl) 4-pyrrolidin-1-ylsulfonylbenzoate is O=C(Oc1cccc([N+](=O)[O-])c1)c1ccc(S(=O)(=O)N2CCCC2)cc1.
What is the InChIKey of (3-nitrophenyl) 4-pyrrolidin-1-ylsulfonylbenzoate?
The InChIKey is ADTSJWAMNAXRSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N2O6S/c20-17(25-15-5-3-4-14(12-15)19(21)22)13-6-8-16(9-7-13)26(23,24)18-10-1-2-11-18/h3-9,12H,1-2,10-11H2.
What are the key properties of (3-nitrophenyl) 4-pyrrolidin-1-ylsulfonylbenzoate?
(3-nitrophenyl) 4-pyrrolidin-1-ylsulfonylbenzoate has a molecular weight of 376.39 g/mol, XLogP of 2.60, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3-nitrophenyl) 4-pyrrolidin-1-ylsulfonylbenzoate is sourced from PubChem (CID 4812746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).