C24H31NO4S — CID 7920660
(4-tert-butyl-2-methylphenyl) 4-(azepan-1-ylsulfonyl)benzoate (PubChem CID 7920660) has the molecular formula C24H31NO4S and a molecular weight of 429.58 g/mol. Its IUPAC name is (4-tert-butyl-2-methylphenyl) 4-(azepan-1-ylsulfonyl)benzoate.
| Compound Name | (4-tert-butyl-2-methylphenyl) 4-(azepan-1-ylsulfonyl)benzoate |
|---|---|
| PubChem CID | 7920660 |
| Molecular Formula | C24H31NO4S |
| Molecular Weight | 429.58 g/mol |
| Exact Mass | 429.20 |
| IUPAC Name | (4-tert-butyl-2-methylphenyl) 4-(azepan-1-ylsulfonyl)benzoate |
| SMILES | Cc1cc(C(C)(C)C)ccc1OC(=O)c1ccc(S(=O)(=O)N2CCCCCC2)cc1 |
| InChI | InChI=1S/C24H31NO4S/c1-18-17-20(24(2,3)4)11-14-22(18)29-23(26)19-9-12-21(13-10-19)30(27,28)25-15-7-5-6-8-16-25/h9-14,17H,5-8,15-16H2,1-4H3 |
| InChIKey | ZOFIAHLJAGVJCV-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.58 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|