C19H19Cl2NO4S — CID 16548658
(2,4-dichlorophenyl) 4-methyl-3-piperidin-1-ylsulfonylbenzoate (PubChem CID 16548658) has the molecular formula C19H19Cl2NO4S and a molecular weight of 428.34 g/mol. Its IUPAC name is (2,4-dichlorophenyl) 4-methyl-3-piperidin-1-ylsulfonylbenzoate.
| Compound Name | (2,4-dichlorophenyl) 4-methyl-3-piperidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 16548658 |
| Molecular Formula | C19H19Cl2NO4S |
| Molecular Weight | 428.34 g/mol |
| Exact Mass | 427.04 |
| IUPAC Name | (2,4-dichlorophenyl) 4-methyl-3-piperidin-1-ylsulfonylbenzoate |
| SMILES | Cc1ccc(C(=O)Oc2ccc(Cl)cc2Cl)cc1S(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C19H19Cl2NO4S/c1-13-5-6-14(19(23)26-17-8-7-15(20)12-16(17)21)11-18(13)27(24,25)22-9-3-2-4-10-22/h5-8,11-12H,2-4,9-10H2,1H3 |
| InChIKey | KIQAMAZAKSKKFV-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.34 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|