C19H21NO4S — CID 2668435
phenyl 4-methyl-3-piperidin-1-ylsulfonylbenzoate (PubChem CID 2668435) has the molecular formula C19H21NO4S and a molecular weight of 359.45 g/mol. Its IUPAC name is phenyl 4-methyl-3-piperidin-1-ylsulfonylbenzoate.
| Compound Name | phenyl 4-methyl-3-piperidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 2668435 |
| Molecular Formula | C19H21NO4S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | phenyl 4-methyl-3-piperidin-1-ylsulfonylbenzoate |
| SMILES | Cc1ccc(C(=O)Oc2ccccc2)cc1S(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C19H21NO4S/c1-15-10-11-16(19(21)24-17-8-4-2-5-9-17)14-18(15)25(22,23)20-12-6-3-7-13-20/h2,4-5,8-11,14H,3,6-7,12-13H2,1H3 |
| InChIKey | SAVGRNHAYSQAKG-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|