C21H24ClNO5S — CID 16528571
2-(3-chlorophenoxy)ethyl 4-methyl-3-piperidin-1-ylsulfonylbenzoate (PubChem CID 16528571) has the molecular formula C21H24ClNO5S and a molecular weight of 437.95 g/mol. Its IUPAC name is 2-(3-chlorophenoxy)ethyl 4-methyl-3-piperidin-1-ylsulfonylbenzoate.
| Compound Name | 2-(3-chlorophenoxy)ethyl 4-methyl-3-piperidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 16528571 |
| Molecular Formula | C21H24ClNO5S |
| Molecular Weight | 437.95 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | 2-(3-chlorophenoxy)ethyl 4-methyl-3-piperidin-1-ylsulfonylbenzoate |
| SMILES | Cc1ccc(C(=O)OCCOc2cccc(Cl)c2)cc1S(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C21H24ClNO5S/c1-16-8-9-17(14-20(16)29(25,26)23-10-3-2-4-11-23)21(24)28-13-12-27-19-7-5-6-18(22)15-19/h5-9,14-15H,2-4,10-13H2,1H3 |
| InChIKey | KQDLVLBMUQZGOG-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.95 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|