C20H22FNO6S — CID 2506192
2-(3-methylphenoxy)ethyl 4-fluoro-3-morpholin-4-ylsulfonylbenzoate (PubChem CID 2506192) has the molecular formula C20H22FNO6S and a molecular weight of 423.46 g/mol. Its IUPAC name is 2-(3-methylphenoxy)ethyl 4-fluoro-3-morpholin-4-ylsulfonylbenzoate.
| Compound Name | 2-(3-methylphenoxy)ethyl 4-fluoro-3-morpholin-4-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 2506192 |
| Molecular Formula | C20H22FNO6S |
| Molecular Weight | 423.46 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | 2-(3-methylphenoxy)ethyl 4-fluoro-3-morpholin-4-ylsulfonylbenzoate |
| SMILES | Cc1cccc(OCCOC(=O)c2ccc(F)c(S(=O)(=O)N3CCOCC3)c2)c1 |
| InChI | InChI=1S/C20H22FNO6S/c1-15-3-2-4-17(13-15)27-11-12-28-20(23)16-5-6-18(21)19(14-16)29(24,25)22-7-9-26-10-8-22/h2-6,13-14H,7-12H2,1H3 |
| InChIKey | JFDOWFUQKKXGHB-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.46 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|