C21H23F2NO5S — CID 55394636
2-(3-methylphenoxy)ethyl 1-(2,5-difluorophenyl)sulfonylpiperidine-4-carboxylate (PubChem CID 55394636) has the molecular formula C21H23F2NO5S and a molecular weight of 439.48 g/mol. Its IUPAC name is 2-(3-methylphenoxy)ethyl 1-(2,5-difluorophenyl)sulfonylpiperidine-4-carboxylate.
| Compound Name | 2-(3-methylphenoxy)ethyl 1-(2,5-difluorophenyl)sulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 55394636 |
| Molecular Formula | C21H23F2NO5S |
| Molecular Weight | 439.48 g/mol |
| Exact Mass | 439.13 |
| IUPAC Name | 2-(3-methylphenoxy)ethyl 1-(2,5-difluorophenyl)sulfonylpiperidine-4-carboxylate |
| SMILES | Cc1cccc(OCCOC(=O)C2CCN(S(=O)(=O)c3cc(F)ccc3F)CC2)c1 |
| InChI | InChI=1S/C21H23F2NO5S/c1-15-3-2-4-18(13-15)28-11-12-29-21(25)16-7-9-24(10-8-16)30(26,27)20-14-17(22)5-6-19(20)23/h2-6,13-14,16H,7-12H2,1H3 |
| InChIKey | JDALYMUZQCXZFL-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.48 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|