C20H24F2N2O3S — CID 8771570
1-(2,4-difluorophenyl)sulfonyl-4-[3-(3-methylphenoxy)propyl]piperazine (PubChem CID 8771570) has the molecular formula C20H24F2N2O3S and a molecular weight of 410.49 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)sulfonyl-4-[3-(3-methylphenoxy)propyl]piperazine.
| Compound Name | 1-(2,4-difluorophenyl)sulfonyl-4-[3-(3-methylphenoxy)propyl]piperazine |
|---|---|
| PubChem CID | 8771570 |
| Molecular Formula | C20H24F2N2O3S |
| Molecular Weight | 410.49 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | 1-(2,4-difluorophenyl)sulfonyl-4-[3-(3-methylphenoxy)propyl]piperazine |
| SMILES | Cc1cccc(OCCCN2CCN(S(=O)(=O)c3ccc(F)cc3F)CC2)c1 |
| InChI | InChI=1S/C20H24F2N2O3S/c1-16-4-2-5-18(14-16)27-13-3-8-23-9-11-24(12-10-23)28(25,26)20-7-6-17(21)15-19(20)22/h2,4-7,14-15H,3,8-13H2,1H3 |
| InChIKey | MSYNQQAAYRUWCM-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.49 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|