C18H19F3N2O3S — CID 8771334
1-(2,4-difluorophenyl)sulfonyl-4-[2-(2-fluorophenoxy)ethyl]piperazine (PubChem CID 8771334) has the molecular formula C18H19F3N2O3S and a molecular weight of 400.42 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)sulfonyl-4-[2-(2-fluorophenoxy)ethyl]piperazine.
| Compound Name | 1-(2,4-difluorophenyl)sulfonyl-4-[2-(2-fluorophenoxy)ethyl]piperazine |
|---|---|
| PubChem CID | 8771334 |
| Molecular Formula | C18H19F3N2O3S |
| Molecular Weight | 400.42 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | 1-(2,4-difluorophenyl)sulfonyl-4-[2-(2-fluorophenoxy)ethyl]piperazine |
| SMILES | O=S(=O)(c1ccc(F)cc1F)N1CCN(CCOc2ccccc2F)CC1 |
| InChI | InChI=1S/C18H19F3N2O3S/c19-14-5-6-18(16(21)13-14)27(24,25)23-9-7-22(8-10-23)11-12-26-17-4-2-1-3-15(17)20/h1-6,13H,7-12H2 |
| InChIKey | APWFWGQTWUTKTC-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.42 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |