C18H18F2N4O2S — CID 17422149
1-[[4-(2,4-difluorophenyl)sulfonylpiperazin-1-yl]methyl]benzimidazole (PubChem CID 17422149) has the molecular formula C18H18F2N4O2S and a molecular weight of 392.43 g/mol. Its IUPAC name is 1-[[4-(2,4-difluorophenyl)sulfonylpiperazin-1-yl]methyl]benzimidazole.
| Compound Name | 1-[[4-(2,4-difluorophenyl)sulfonylpiperazin-1-yl]methyl]benzimidazole |
|---|---|
| PubChem CID | 17422149 |
| Molecular Formula | C18H18F2N4O2S |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | 1-[[4-(2,4-difluorophenyl)sulfonylpiperazin-1-yl]methyl]benzimidazole |
| SMILES | O=S(=O)(c1ccc(F)cc1F)N1CCN(Cn2cnc3ccccc32)CC1 |
| InChI | InChI=1S/C18H18F2N4O2S/c19-14-5-6-18(15(20)11-14)27(25,26)24-9-7-22(8-10-24)13-23-12-21-16-3-1-2-4-17(16)23/h1-6,11-12H,7-10,13H2 |
| InChIKey | NABODUCIHVJBAU-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |