C16H15F2N3O2S — CID 51200722
N-[3-(benzimidazol-1-yl)propyl]-2,4-difluorobenzenesulfonamide (PubChem CID 51200722) has the molecular formula C16H15F2N3O2S and a molecular weight of 351.38 g/mol. Its IUPAC name is N-[3-(benzimidazol-1-yl)propyl]-2,4-difluorobenzenesulfonamide.
| Compound Name | N-[3-(benzimidazol-1-yl)propyl]-2,4-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 51200722 |
| Molecular Formula | C16H15F2N3O2S |
| Molecular Weight | 351.38 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | N-[3-(benzimidazol-1-yl)propyl]-2,4-difluorobenzenesulfonamide |
| SMILES | O=S(=O)(NCCCn1cnc2ccccc21)c1ccc(F)cc1F |
| InChI | InChI=1S/C16H15F2N3O2S/c17-12-6-7-16(13(18)10-12)24(22,23)20-8-3-9-21-11-19-14-4-1-2-5-15(14)21/h1-2,4-7,10-11,20H,3,8-9H2 |
| InChIKey | KHSUTINLGDHOAJ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.38 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|