C19H22F2N2O2S — CID 21092238
N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)butyl]-2,4-difluorobenzenesulfonamide (PubChem CID 21092238) has the molecular formula C19H22F2N2O2S and a molecular weight of 380.46 g/mol. Its IUPAC name is N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)butyl]-2,4-difluorobenzenesulfonamide.
| Compound Name | N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)butyl]-2,4-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 21092238 |
| Molecular Formula | C19H22F2N2O2S |
| Molecular Weight | 380.46 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)butyl]-2,4-difluorobenzenesulfonamide |
| SMILES | O=S(=O)(NCCCCN1CCc2ccccc2C1)c1ccc(F)cc1F |
| InChI | InChI=1S/C19H22F2N2O2S/c20-17-7-8-19(18(21)13-17)26(24,25)22-10-3-4-11-23-12-9-15-5-1-2-6-16(15)14-23/h1-2,5-8,13,22H,3-4,9-12,14H2 |
| InChIKey | JHNMYDPLNORSDW-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.46 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|