C25H36N2O2S — CID 21092347
N-[5-(3,4-dihydro-1H-isoquinolin-2-yl)pentyl]-2,3,4,5,6-pentamethylbenzenesulfonamide (PubChem CID 21092347) has the molecular formula C25H36N2O2S and a molecular weight of 428.64 g/mol. Its IUPAC name is N-[5-(3,4-dihydro-1H-isoquinolin-2-yl)pentyl]-2,3,4,5,6-pentamethylbenzenesulfonamide.
| Compound Name | N-[5-(3,4-dihydro-1H-isoquinolin-2-yl)pentyl]-2,3,4,5,6-pentamethylbenzenesulfonamide |
|---|---|
| PubChem CID | 21092347 |
| Molecular Formula | C25H36N2O2S |
| Molecular Weight | 428.64 g/mol |
| Exact Mass | 428.25 |
| IUPAC Name | N-[5-(3,4-dihydro-1H-isoquinolin-2-yl)pentyl]-2,3,4,5,6-pentamethylbenzenesulfonamide |
| SMILES | Cc1c(C)c(C)c(S(=O)(=O)NCCCCCN2CCc3ccccc3C2)c(C)c1C |
| InChI | InChI=1S/C25H36N2O2S/c1-18-19(2)21(4)25(22(5)20(18)3)30(28,29)26-14-9-6-10-15-27-16-13-23-11-7-8-12-24(23)17-27/h7-8,11-12,26H,6,9-10,13-17H2,1-5H3 |
| InChIKey | WJVCVZHSPUIUJT-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.64 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|