C19H27ClN2O2S2 — CID 21092413
N-[6-(3,4-dihydro-1H-isoquinolin-2-yl)hexyl]thiophene-2-sulfonamide;hydrochloride (PubChem CID 21092413) has the molecular formula C19H27ClN2O2S2 and a molecular weight of 415.02 g/mol. Its IUPAC name is N-[6-(3,4-dihydro-1H-isoquinolin-2-yl)hexyl]thiophene-2-sulfonamide;hydrochloride.
| Compound Name | N-[6-(3,4-dihydro-1H-isoquinolin-2-yl)hexyl]thiophene-2-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 21092413 |
| Molecular Formula | C19H27ClN2O2S2 |
| Molecular Weight | 415.02 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | N-[6-(3,4-dihydro-1H-isoquinolin-2-yl)hexyl]thiophene-2-sulfonamide;hydrochloride |
| SMILES | Cl.O=S(=O)(NCCCCCCN1CCc2ccccc2C1)c1cccs1 |
| InChI | InChI=1S/C19H26N2O2S2.ClH/c22-25(23,19-10-7-15-24-19)20-12-5-1-2-6-13-21-14-11-17-8-3-4-9-18(17)16-21;/h3-4,7-10,15,20H,1-2,5-6,11-14,16H2;1H |
| InChIKey | LWSMLQGSCLABAC-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.02 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|