C10H16N2O2S2 — CID 91007223
N-(2-pyrrolidin-1-ylethyl)thiophene-2-sulfonamide (PubChem CID 91007223) has the molecular formula C10H16N2O2S2 and a molecular weight of 260.38 g/mol. Its IUPAC name is N-(2-pyrrolidin-1-ylethyl)thiophene-2-sulfonamide.
| Compound Name | N-(2-pyrrolidin-1-ylethyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 91007223 |
| Molecular Formula | C10H16N2O2S2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | N-(2-pyrrolidin-1-ylethyl)thiophene-2-sulfonamide |
| SMILES | O=S(=O)(NCCN1CCCC1)c1cccs1 |
| InChI | InChI=1S/C10H16N2O2S2/c13-16(14,10-4-3-9-15-10)11-5-8-12-6-1-2-7-12/h3-4,9,11H,1-2,5-8H2 |
| InChIKey | SNIDRRDWLPJCOF-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |