C12H20N2O2S2 — CID 94197160
N-[2-[(2S)-2-methylpiperidin-1-yl]ethyl]thiophene-2-sulfonamide (PubChem CID 94197160) has the molecular formula C12H20N2O2S2 and a molecular weight of 288.44 g/mol. Its IUPAC name is N-[2-[(2S)-2-methylpiperidin-1-yl]ethyl]thiophene-2-sulfonamide.
| Compound Name | N-[2-[(2S)-2-methylpiperidin-1-yl]ethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 94197160 |
| Molecular Formula | C12H20N2O2S2 |
| Molecular Weight | 288.44 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | N-[2-[(2S)-2-methylpiperidin-1-yl]ethyl]thiophene-2-sulfonamide |
| SMILES | C[C@H]1CCCCN1CCNS(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C12H20N2O2S2/c1-11-5-2-3-8-14(11)9-7-13-18(15,16)12-6-4-10-17-12/h4,6,10-11,13H,2-3,5,7-9H2,1H3/t11-/m0/s1 |
| InChIKey | MYYFNELHNQGUSS-NSHDSACASA-N |
| XLogP | 1.90 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.44 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |